C22H34N4O4 — CID 67550447
tert-butyl 4-(tert-butylcarbamoyloxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylate (PubChem CID 67550447) has the molecular formula C22H34N4O4 and a molecular weight of 418.54 g/mol. Its IUPAC name is tert-butyl 4-(tert-butylcarbamoyloxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylate.
| Compound Name | tert-butyl 4-(tert-butylcarbamoyloxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylate |
|---|---|
| PubChem CID | 67550447 |
| Molecular Formula | C22H34N4O4 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | tert-butyl 4-(tert-butylcarbamoyloxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CC2Cc3ccc(COC(=O)NC(C)(C)C)nc3N12 |
| InChI | InChI=1S/C22H34N4O4/c1-14-11-25(20(28)30-22(5,6)7)12-17-10-15-8-9-16(23-18(15)26(14)17)13-29-19(27)24-21(2,3)4/h8-9,14,17H,10-13H2,1-7H3,(H,24,27) |
| InChIKey | LRUTYGSURQSCPZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |