C16H23N3O3 — CID 151513136
(9R,13R)-4-(3-methoxypropyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylic acid (PubChem CID 151513136) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is (9R,13R)-4-(3-methoxypropyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylic acid.
| Compound Name | (9R,13R)-4-(3-methoxypropyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylic acid |
|---|---|
| PubChem CID | 151513136 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | (9R,13R)-4-(3-methoxypropyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylic acid |
| SMILES | COCCCc1ccc2c(n1)N1[C@H](C2)CN(C(=O)O)C[C@H]1C |
| InChI | InChI=1S/C16H23N3O3/c1-11-9-18(16(20)21)10-14-8-12-5-6-13(4-3-7-22-2)17-15(12)19(11)14/h5-6,11,14H,3-4,7-10H2,1-2H3,(H,20,21)/t11-,14-/m1/s1 |
| InChIKey | PSXAPODJQJOUFM-BXUZGUMPSA-N |
| XLogP | 1.77 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|