C13H17N3O3 — CID 141072830
(9R,13R)-4-(hydroxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylic acid (PubChem CID 141072830) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is (9R,13R)-4-(hydroxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylic acid.
| Compound Name | (9R,13R)-4-(hydroxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylic acid |
|---|---|
| PubChem CID | 141072830 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (9R,13R)-4-(hydroxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylic acid |
| SMILES | C[C@@H]1CN(C(=O)O)C[C@H]2Cc3ccc(CO)nc3N21 |
| InChI | InChI=1S/C13H17N3O3/c1-8-5-15(13(18)19)6-11-4-9-2-3-10(7-17)14-12(9)16(8)11/h2-3,8,11,17H,4-7H2,1H3,(H,18,19)/t8-,11-/m1/s1 |
| InChIKey | IWROVQOKFOJUBL-LDYMZIIASA-N |
| XLogP | 0.69 |
| TPSA | 76.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |