C18H26N4O4 — CID 150634348
(9R,13R)-4-(tert-butylcarbamoyloxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylic acid (PubChem CID 150634348) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is (9R,13R)-4-(tert-butylcarbamoyloxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylic acid.
| Compound Name | (9R,13R)-4-(tert-butylcarbamoyloxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylic acid |
|---|---|
| PubChem CID | 150634348 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (9R,13R)-4-(tert-butylcarbamoyloxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylic acid |
| SMILES | C[C@@H]1CN(C(=O)O)C[C@H]2Cc3ccc(COC(=O)NC(C)(C)C)nc3N21 |
| InChI | InChI=1S/C18H26N4O4/c1-11-8-21(17(24)25)9-14-7-12-5-6-13(19-15(12)22(11)14)10-26-16(23)20-18(2,3)4/h5-6,11,14H,7-10H2,1-4H3,(H,20,23)(H,24,25)/t11-,14-/m1/s1 |
| InChIKey | IYOKSPUVUYDOIL-BXUZGUMPSA-N |
| XLogP | 2.22 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |