C18H24FN3O3 — CID 87797321
tert-butyl (9R,13R)-4-(fluoromethyl)-5-formyl-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate (PubChem CID 87797321) has the molecular formula C18H24FN3O3 and a molecular weight of 349.41 g/mol. Its IUPAC name is tert-butyl (9R,13R)-4-(fluoromethyl)-5-formyl-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate.
| Compound Name | tert-butyl (9R,13R)-4-(fluoromethyl)-5-formyl-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate |
|---|---|
| PubChem CID | 87797321 |
| Molecular Formula | C18H24FN3O3 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | tert-butyl (9R,13R)-4-(fluoromethyl)-5-formyl-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)C[C@H]2Cc3cc(C=O)c(CF)nc3N21 |
| InChI | InChI=1S/C18H24FN3O3/c1-11-8-21(17(24)25-18(2,3)4)9-14-6-12-5-13(10-23)15(7-19)20-16(12)22(11)14/h5,10-11,14H,6-9H2,1-4H3/t11-,14-/m1/s1 |
| InChIKey | HMSYSBNVKUJEHY-BXUZGUMPSA-N |
| XLogP | 2.73 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|