C22H28N2O5S — CID 69396370
[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-(thiophen-2-ylmethyl)carbamoyl]phenyl] acetate (PubChem CID 69396370) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is [2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-(thiophen-2-ylmethyl)carbamoyl]phenyl] acetate.
| Compound Name | [2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-(thiophen-2-ylmethyl)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 69396370 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-(thiophen-2-ylmethyl)carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)N(CCCNC(=O)OC(C)(C)C)Cc1cccs1 |
| InChI | InChI=1S/C22H28N2O5S/c1-16(25)28-19-11-6-5-10-18(19)20(26)24(15-17-9-7-14-30-17)13-8-12-23-21(27)29-22(2,3)4/h5-7,9-11,14H,8,12-13,15H2,1-4H3,(H,23,27) |
| InChIKey | XYGVUSYMUFJAQK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|