C15H19N2+ — CID 6940373
5,7-dimethyl-1,2,3,4-tetrahydroacridin-10-ium-9-amine (PubChem CID 6940373) has the molecular formula C15H19N2+ and a molecular weight of 227.33 g/mol. Its IUPAC name is 5,7-dimethyl-1,2,3,4-tetrahydroacridin-10-ium-9-amine.
| Compound Name | 5,7-dimethyl-1,2,3,4-tetrahydroacridin-10-ium-9-amine |
|---|---|
| PubChem CID | 6940373 |
| Molecular Formula | C15H19N2+ |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 5,7-dimethyl-1,2,3,4-tetrahydroacridin-10-ium-9-amine |
| SMILES | Cc1cc(C)c2[nH+]c3c(c(N)c2c1)CCCC3 |
| InChI | InChI=1S/C15H18N2/c1-9-7-10(2)15-12(8-9)14(16)11-5-3-4-6-13(11)17-15/h7-8H,3-6H2,1-2H3,(H2,16,17)/p+1 |
| InChIKey | AJDMOOPMKMTOLB-UHFFFAOYSA-O |
| XLogP | 2.73 |
| TPSA | 40.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |