C16H30N2 — CID 69409218
3-pentyl-N,N-bis(prop-2-enyl)piperidin-4-amine (PubChem CID 69409218) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is 3-pentyl-N,N-bis(prop-2-enyl)piperidin-4-amine.
| Compound Name | 3-pentyl-N,N-bis(prop-2-enyl)piperidin-4-amine |
|---|---|
| PubChem CID | 69409218 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | 3-pentyl-N,N-bis(prop-2-enyl)piperidin-4-amine |
| SMILES | C=CCN(CC=C)C1CCNCC1CCCCC |
| InChI | InChI=1S/C16H30N2/c1-4-7-8-9-15-14-17-11-10-16(15)18(12-5-2)13-6-3/h5-6,15-17H,2-4,7-14H2,1H3 |
| InChIKey | HGMRFAMPZYRYRT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|