C29H25N3O3S — CID 69456534
2-benzyl-3-(benzylamino)-5-[(2-oxo-1H-indol-3-ylidene)methyl]benzenesulfonamide (PubChem CID 69456534) has the molecular formula C29H25N3O3S and a molecular weight of 495.60 g/mol. Its IUPAC name is 2-benzyl-3-(benzylamino)-5-[(2-oxo-1H-indol-3-ylidene)methyl]benzenesulfonamide.
| Compound Name | 2-benzyl-3-(benzylamino)-5-[(2-oxo-1H-indol-3-ylidene)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 69456534 |
| Molecular Formula | C29H25N3O3S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 2-benzyl-3-(benzylamino)-5-[(2-oxo-1H-indol-3-ylidene)methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(C=C2C(=O)Nc3ccccc32)cc(NCc2ccccc2)c1Cc1ccccc1 |
| InChI | InChI=1S/C29H25N3O3S/c30-36(34,35)28-18-22(16-24-23-13-7-8-14-26(23)32-29(24)33)17-27(31-19-21-11-5-2-6-12-21)25(28)15-20-9-3-1-4-10-20/h1-14,16-18,31H,15,19H2,(H,32,33)(H2,30,34,35) |
| InChIKey | VIIKJPBLEFVHHS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|