About CID 69471321
CID 69471321 (PubChem CID 69471321) has the molecular formula C22H20N5O3Si
and a molecular weight of 430.52 g/mol.
Molecular Properties
| Compound Name | CID 69471321 |
| PubChem CID | 69471321 |
| Molecular Formula | C22H20N5O3Si |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | — |
| SMILES | COc1cc2ncnc(N3CC([Si])C(Oc4cnc5ccccc5n4)C3)c2cc1OC |
| InChI | InChI=1S/C22H20N5O3Si/c1-28-17-7-13-16(8-18(17)29-2)24-12-25-22(13)27-10-19(20(31)11-27)30-21-9-23-14-5-3-4-6-15(14)26-21/h3-9,12,19-20H,10-11H2,1-2H3 |
| InChIKey | GSSXDBFVXSSSST-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 82.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 69471321 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69471321?
The IUPAC name of CID 69471321 (CID 69471321) is not available.
What is the SMILES notation for CID 69471321?
The canonical SMILES for CID 69471321 is COc1cc2ncnc(N3CC([Si])C(Oc4cnc5ccccc5n4)C3)c2cc1OC.
What is the InChIKey of CID 69471321?
The InChIKey is GSSXDBFVXSSSST-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N5O3Si/c1-28-17-7-13-16(8-18(17)29-2)24-12-25-22(13)27-10-19(20(31)11-27)30-21-9-23-14-5-3-4-6-15(14)26-21/h3-9,12,19-20H,10-11H2,1-2H3.
What are the key properties of CID 69471321?
CID 69471321 has a molecular weight of 430.52 g/mol, XLogP of 2.81, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69471321 is sourced from PubChem (CID 69471321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).