C22H20N5O3Si — CID 69471321
CID 69471321 (PubChem CID 69471321) has the molecular formula C22H20N5O3Si and a molecular weight of 430.52 g/mol.
| Compound Name | CID 69471321 |
|---|---|
| PubChem CID | 69471321 |
| Molecular Formula | C22H20N5O3Si |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | — |
| SMILES | COc1cc2ncnc(N3CC([Si])C(Oc4cnc5ccccc5n4)C3)c2cc1OC |
| InChI | InChI=1S/C22H20N5O3Si/c1-28-17-7-13-16(8-18(17)29-2)24-12-25-22(13)27-10-19(20(31)11-27)30-21-9-23-14-5-3-4-6-15(14)26-21/h3-9,12,19-20H,10-11H2,1-2H3 |
| InChIKey | GSSXDBFVXSSSST-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 82.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|