C20H18ClNO4 — CID 69487470
[1-(4-chlorobenzoyl)-4-ethyl-5-hydroxy-2-methylindol-3-yl] acetate (PubChem CID 69487470) has the molecular formula C20H18ClNO4 and a molecular weight of 371.82 g/mol. Its IUPAC name is [1-(4-chlorobenzoyl)-4-ethyl-5-hydroxy-2-methylindol-3-yl] acetate.
| Compound Name | [1-(4-chlorobenzoyl)-4-ethyl-5-hydroxy-2-methylindol-3-yl] acetate |
|---|---|
| PubChem CID | 69487470 |
| Molecular Formula | C20H18ClNO4 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | [1-(4-chlorobenzoyl)-4-ethyl-5-hydroxy-2-methylindol-3-yl] acetate |
| SMILES | CCc1c(O)ccc2c1c(OC(C)=O)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClNO4/c1-4-15-17(24)10-9-16-18(15)19(26-12(3)23)11(2)22(16)20(25)13-5-7-14(21)8-6-13/h5-10,24H,4H2,1-3H3 |
| InChIKey | ADWROVMFPHOZEG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |