C22H22ClNO4 — CID 69485119
[4-butyl-1-(4-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl] acetate (PubChem CID 69485119) has the molecular formula C22H22ClNO4 and a molecular weight of 399.87 g/mol. Its IUPAC name is [4-butyl-1-(4-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl] acetate.
| Compound Name | [4-butyl-1-(4-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl] acetate |
|---|---|
| PubChem CID | 69485119 |
| Molecular Formula | C22H22ClNO4 |
| Molecular Weight | 399.87 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | [4-butyl-1-(4-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl] acetate |
| SMILES | CCCCc1c(O)ccc2c1c(OC(C)=O)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H22ClNO4/c1-4-5-6-17-19(26)12-11-18-20(17)21(28-14(3)25)13(2)24(18)22(27)15-7-9-16(23)10-8-15/h7-12,26H,4-6H2,1-3H3 |
| InChIKey | MWKAUKUKDCQHRL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.87 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |