C19H26O3 — CID 69493848
(9S,10S,13R)-10,13-dimethyl-4,5,6,7,9,11,12,17-octahydro-3H-cyclopenta[a]phenanthrene-1,2,3-triol (PubChem CID 69493848) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (9S,10S,13R)-10,13-dimethyl-4,5,6,7,9,11,12,17-octahydro-3H-cyclopenta[a]phenanthrene-1,2,3-triol.
| Compound Name | (9S,10S,13R)-10,13-dimethyl-4,5,6,7,9,11,12,17-octahydro-3H-cyclopenta[a]phenanthrene-1,2,3-triol |
|---|---|
| PubChem CID | 69493848 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (9S,10S,13R)-10,13-dimethyl-4,5,6,7,9,11,12,17-octahydro-3H-cyclopenta[a]phenanthrene-1,2,3-triol |
| SMILES | C[C@@]12CC=CC1=C1CCC3CC(O)C(O)=C(O)[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C19H26O3/c1-18-8-3-4-13(18)12-6-5-11-10-15(20)16(21)17(22)19(11,2)14(12)7-9-18/h3-4,11,14-15,20-22H,5-10H2,1-2H3/t11?,14-,15?,18-,19-/m0/s1 |
| InChIKey | PCMNKIOVUUVTSY-OLNCKWMESA-N |
| XLogP | 4.17 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |