C20H26N+ — CID 6992644
dimethyl-[2-[(2S,9S)-2-methyl-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl]ethyl]azanium (PubChem CID 6992644) has the molecular formula C20H26N+ and a molecular weight of 280.44 g/mol. Its IUPAC name is dimethyl-[2-[(2S,9S)-2-methyl-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl]ethyl]azanium.
| Compound Name | dimethyl-[2-[(2S,9S)-2-methyl-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl]ethyl]azanium |
|---|---|
| PubChem CID | 6992644 |
| Molecular Formula | C20H26N+ |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.21 |
| IUPAC Name | dimethyl-[2-[(2S,9S)-2-methyl-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl]ethyl]azanium |
| SMILES | C[C@H]1c2ccccc2C[C@@H](CC[NH+](C)C)c2ccccc21 |
| InChI | InChI=1S/C20H25N/c1-15-18-9-5-4-8-16(18)14-17(12-13-21(2)3)20-11-7-6-10-19(15)20/h4-11,15,17H,12-14H2,1-3H3/p+1/t15-,17+/m0/s1 |
| InChIKey | LYMOVRPSPQDFNQ-DOTOQJQBSA-O |
| XLogP | 3.01 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |