C14H20N4O4 — CID 6998276
(5S)-5-(2-morpholin-4-ylethyliminomethyl)-1-prop-2-enyl-1,3-diazinane-2,4,6-trione (PubChem CID 6998276) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is (5S)-5-(2-morpholin-4-ylethyliminomethyl)-1-prop-2-enyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5S)-5-(2-morpholin-4-ylethyliminomethyl)-1-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 6998276 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (5S)-5-(2-morpholin-4-ylethyliminomethyl)-1-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCN1C(=O)NC(=O)[C@H](/C=N/CCN2CCOCC2)C1=O |
| InChI | InChI=1S/C14H20N4O4/c1-2-4-18-13(20)11(12(19)16-14(18)21)10-15-3-5-17-6-8-22-9-7-17/h2,10-11H,1,3-9H2,(H,16,19,21)/b15-10+/t11-/m0/s1 |
| InChIKey | IIWCPNCWRURCLA-KBVGCWLLSA-N |
| XLogP | -0.73 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|