C20H20F2IN3O2S2 — CID 70008745
5-[3-[(2,2-difluoroacetyl)amino]phenyl]sulfanyl-N-[(3R)-2-iodo-1-azabicyclo[2.2.2]octan-3-yl]thiophene-2-carboxamide (PubChem CID 70008745) has the molecular formula C20H20F2IN3O2S2 and a molecular weight of 563.43 g/mol. Its IUPAC name is 5-[3-[(2,2-difluoroacetyl)amino]phenyl]sulfanyl-N-[(3R)-2-iodo-1-azabicyclo[2.2.2]octan-3-yl]thiophene-2-carboxamide.
| Compound Name | 5-[3-[(2,2-difluoroacetyl)amino]phenyl]sulfanyl-N-[(3R)-2-iodo-1-azabicyclo[2.2.2]octan-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 70008745 |
| Molecular Formula | C20H20F2IN3O2S2 |
| Molecular Weight | 563.43 g/mol |
| Exact Mass | 563.00 |
| IUPAC Name | 5-[3-[(2,2-difluoroacetyl)amino]phenyl]sulfanyl-N-[(3R)-2-iodo-1-azabicyclo[2.2.2]octan-3-yl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@@H]1C2CCN(CC2)C1I)c1ccc(Sc2cccc(NC(=O)C(F)F)c2)s1 |
| InChI | InChI=1S/C20H20F2IN3O2S2/c21-17(22)20(28)24-12-2-1-3-13(10-12)29-15-5-4-14(30-15)19(27)25-16-11-6-8-26(9-7-11)18(16)23/h1-5,10-11,16-18H,6-9H2,(H,24,28)(H,25,27)/t16-,18?/m1/s1 |
| InChIKey | FMZLMVBDXBTRBF-PYUWXLGESA-N |
| XLogP | 4.69 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|