C27H39N3O — CID 70030296
2-piperazin-1-yl-3-[(2E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-3H-isoindol-1-one (PubChem CID 70030296) has the molecular formula C27H39N3O and a molecular weight of 421.63 g/mol. Its IUPAC name is 2-piperazin-1-yl-3-[(2E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-3H-isoindol-1-one.
| Compound Name | 2-piperazin-1-yl-3-[(2E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 70030296 |
| Molecular Formula | C27H39N3O |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.31 |
| IUPAC Name | 2-piperazin-1-yl-3-[(2E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-3H-isoindol-1-one |
| SMILES | CC(C)=CCCC(C)=CCC/C(C)=C/CC1c2ccccc2C(=O)N1N1CCNCC1 |
| InChI | InChI=1S/C27H39N3O/c1-21(2)9-7-10-22(3)11-8-12-23(4)15-16-26-24-13-5-6-14-25(24)27(31)30(26)29-19-17-28-18-20-29/h5-6,9,11,13-15,26,28H,7-8,10,12,16-20H2,1-4H3/b22-11?,23-15+ |
| InChIKey | HORHWVQAEVRVQT-DORLNVPESA-N |
| XLogP | 5.81 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|