C29H41N3O5 — CID 70047497
tert-butyl N-[[1-amino-4-hydroxy-3-methyl-1-oxo-2-[(2-phenylphenyl)methyl]butan-2-yl]-hexanoylamino]carbamate (PubChem CID 70047497) has the molecular formula C29H41N3O5 and a molecular weight of 511.66 g/mol. Its IUPAC name is tert-butyl N-[[1-amino-4-hydroxy-3-methyl-1-oxo-2-[(2-phenylphenyl)methyl]butan-2-yl]-hexanoylamino]carbamate.
| Compound Name | tert-butyl N-[[1-amino-4-hydroxy-3-methyl-1-oxo-2-[(2-phenylphenyl)methyl]butan-2-yl]-hexanoylamino]carbamate |
|---|---|
| PubChem CID | 70047497 |
| Molecular Formula | C29H41N3O5 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | tert-butyl N-[[1-amino-4-hydroxy-3-methyl-1-oxo-2-[(2-phenylphenyl)methyl]butan-2-yl]-hexanoylamino]carbamate |
| SMILES | CCCCCC(=O)N(NC(=O)OC(C)(C)C)C(Cc1ccccc1-c1ccccc1)(C(N)=O)C(C)CO |
| InChI | InChI=1S/C29H41N3O5/c1-6-7-9-18-25(34)32(31-27(36)37-28(3,4)5)29(26(30)35,21(2)20-33)19-23-16-12-13-17-24(23)22-14-10-8-11-15-22/h8,10-17,21,33H,6-7,9,18-20H2,1-5H3,(H2,30,35)(H,31,36) |
| InChIKey | ATTLQXWLQBAYBQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|