C17H17F3N2O4 — CID 70060768
(7-methoxy-8-prop-2-enoxynaphthalen-2-yl)methylidenehydrazine;2,2,2-trifluoroacetic acid (PubChem CID 70060768) has the molecular formula C17H17F3N2O4 and a molecular weight of 370.33 g/mol. Its IUPAC name is (7-methoxy-8-prop-2-enoxynaphthalen-2-yl)methylidenehydrazine;2,2,2-trifluoroacetic acid.
| Compound Name | (7-methoxy-8-prop-2-enoxynaphthalen-2-yl)methylidenehydrazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70060768 |
| Molecular Formula | C17H17F3N2O4 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (7-methoxy-8-prop-2-enoxynaphthalen-2-yl)methylidenehydrazine;2,2,2-trifluoroacetic acid |
| SMILES | C=CCOc1c(OC)ccc2ccc(C=NN)cc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H16N2O2.C2HF3O2/c1-3-8-19-15-13-9-11(10-17-16)4-5-12(13)6-7-14(15)18-2;3-2(4,5)1(6)7/h3-7,9-10H,1,8,16H2,2H3;(H,6,7) |
| InChIKey | XTIHVCQVRXHANI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|