C27H25N7O3 — CID 70081545
[4-[4-[[(2S)-2-(3-carbamimidoylanilino)-3-pyridin-4-ylpropanoyl]amino]phenyl]-2-pyridinyl] carbamate (PubChem CID 70081545) has the molecular formula C27H25N7O3 and a molecular weight of 495.54 g/mol. Its IUPAC name is [4-[4-[[(2S)-2-(3-carbamimidoylanilino)-3-pyridin-4-ylpropanoyl]amino]phenyl]-2-pyridinyl] carbamate.
| Compound Name | [4-[4-[[(2S)-2-(3-carbamimidoylanilino)-3-pyridin-4-ylpropanoyl]amino]phenyl]-2-pyridinyl] carbamate |
|---|---|
| PubChem CID | 70081545 |
| Molecular Formula | C27H25N7O3 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | [4-[4-[[(2S)-2-(3-carbamimidoylanilino)-3-pyridin-4-ylpropanoyl]amino]phenyl]-2-pyridinyl] carbamate |
| SMILES | [H]/N=C(\N)c1cccc(N[C@@H](Cc2ccncc2)C(=O)Nc2ccc(-c3ccnc(OC(N)=O)c3)cc2)c1 |
| InChI | InChI=1S/C27H25N7O3/c28-25(29)20-2-1-3-22(15-20)33-23(14-17-8-11-31-12-9-17)26(35)34-21-6-4-18(5-7-21)19-10-13-32-24(16-19)37-27(30)36/h1-13,15-16,23,33H,14H2,(H3,28,29)(H2,30,36)(H,34,35)/t23-/m0/s1 |
| InChIKey | SLZPZHCSRSKHPF-QHCPKHFHSA-N |
| XLogP | 3.55 |
| TPSA | 169.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|