C19H17N3O3 — CID 70112959
5-(5,12-dimethyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,8,11,13-hexaen-2-yl)-1-methylpyrimidine-2,4-dione (PubChem CID 70112959) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is 5-(5,12-dimethyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,8,11,13-hexaen-2-yl)-1-methylpyrimidine-2,4-dione.
| Compound Name | 5-(5,12-dimethyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,8,11,13-hexaen-2-yl)-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70112959 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 5-(5,12-dimethyl-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,8,11,13-hexaen-2-yl)-1-methylpyrimidine-2,4-dione |
| SMILES | Cc1ccc2c(c1)C=Cc1oc(C)nc1C2c1cn(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H17N3O3/c1-10-4-6-13-12(8-10)5-7-15-17(20-11(2)25-15)16(13)14-9-22(3)19(24)21-18(14)23/h4-9,16H,1-3H3,(H,21,23,24) |
| InChIKey | MKFUXXIZFXCRMR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |