About 4-ethylbenzamide
4-ethylbenzamide (PubChem CID 7020622) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 4-ethylbenzamide.
Molecular Properties
| Compound Name | 4-ethylbenzamide |
| PubChem CID | 7020622 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 4-ethylbenzamide |
| SMILES | CCc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C9H11NO/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6H,2H2,1H3,(H2,10,11) |
| InChIKey | YKFAFWKDOSYQIP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylbenzamide?
The IUPAC name of 4-ethylbenzamide (CID 7020622) is 4-ethylbenzamide.
What is the SMILES notation for 4-ethylbenzamide?
The canonical SMILES for 4-ethylbenzamide is CCc1ccc(C(N)=O)cc1.
What is the InChIKey of 4-ethylbenzamide?
The InChIKey is YKFAFWKDOSYQIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6H,2H2,1H3,(H2,10,11).
What are the key properties of 4-ethylbenzamide?
4-ethylbenzamide has a molecular weight of 149.19 g/mol, XLogP of 1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylbenzamide is sourced from PubChem (CID 7020622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).