C17H14FN3O5 — CID 70257175
4-[[2-(7-fluoro-1-benzofuran-4-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]piperazine-1-carboxylic acid (PubChem CID 70257175) has the molecular formula C17H14FN3O5 and a molecular weight of 359.31 g/mol. Its IUPAC name is 4-[[2-(7-fluoro-1-benzofuran-4-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[[2-(7-fluoro-1-benzofuran-4-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 70257175 |
| Molecular Formula | C17H14FN3O5 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 4-[[2-(7-fluoro-1-benzofuran-4-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]piperazine-1-carboxylic acid |
| SMILES | O=C1OC(c2ccc(F)c3occc23)=NC1=CN1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C17H14FN3O5/c18-12-2-1-11(10-3-8-25-14(10)12)15-19-13(16(22)26-15)9-20-4-6-21(7-5-20)17(23)24/h1-3,8-9H,4-7H2,(H,23,24) |
| InChIKey | RFLKJBURLBGZEI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|