C18H28N6O12 — CID 70307864
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;bis(piperazine-2,3-dione) (PubChem CID 70307864) has the molecular formula C18H28N6O12 and a molecular weight of 520.45 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;bis(piperazine-2,3-dione).
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;bis(piperazine-2,3-dione) |
|---|---|
| PubChem CID | 70307864 |
| Molecular Formula | C18H28N6O12 |
| Molecular Weight | 520.45 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;bis(piperazine-2,3-dione) |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O.O=C1NCCNC1=O.O=C1NCCNC1=O |
| InChI | InChI=1S/C10H16N2O8.2C4H6N2O2/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;2*7-3-4(8)6-2-1-5-3/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);2*1-2H2,(H,5,7)(H,6,8) |
| InChIKey | HKVCDNLJCZWLNC-UHFFFAOYSA-N |
| XLogP | -5.61 |
| TPSA | 272.08 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.45 |
| LogP ≤ 5 | -5.61 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|