C21H27F3N4 — CID 70319603
(2R)-5-(2-cyclopropyl-4a,5,7,7a-tetrahydropyrrolo[3,4-d]pyrimidin-6-yl)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)cyclohexan-1-amine (PubChem CID 70319603) has the molecular formula C21H27F3N4 and a molecular weight of 392.47 g/mol. Its IUPAC name is (2R)-5-(2-cyclopropyl-4a,5,7,7a-tetrahydropyrrolo[3,4-d]pyrimidin-6-yl)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)cyclohexan-1-amine.
| Compound Name | (2R)-5-(2-cyclopropyl-4a,5,7,7a-tetrahydropyrrolo[3,4-d]pyrimidin-6-yl)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 70319603 |
| Molecular Formula | C21H27F3N4 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (2R)-5-(2-cyclopropyl-4a,5,7,7a-tetrahydropyrrolo[3,4-d]pyrimidin-6-yl)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)cyclohexan-1-amine |
| SMILES | NC1CC(N2CC3C=NC(C4CC4)=NC3C2)CC[C@@H]1C1CC(F)=C(F)C=C1F |
| InChI | InChI=1S/C21H27F3N4/c22-16-7-18(24)17(23)6-15(16)14-4-3-13(5-19(14)25)28-9-12-8-26-21(11-1-2-11)27-20(12)10-28/h7-8,11-15,19-20H,1-6,9-10,25H2/t12?,13?,14-,15?,19?,20?/m1/s1 |
| InChIKey | BMDSYTSIQNUDRG-BMPBXONSSA-N |
| XLogP | 3.70 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |