C6H9NO2S — CID 70320458
3,5-dimethyl-4-methylsulfinyl-1,2-oxazole (PubChem CID 70320458) has the molecular formula C6H9NO2S and a molecular weight of 159.21 g/mol. Its IUPAC name is 3,5-dimethyl-4-methylsulfinyl-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-methylsulfinyl-1,2-oxazole |
|---|---|
| PubChem CID | 70320458 |
| Molecular Formula | C6H9NO2S |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | 3,5-dimethyl-4-methylsulfinyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1S(C)=O |
| InChI | InChI=1S/C6H9NO2S/c1-4-6(10(3)8)5(2)9-7-4/h1-3H3 |
| InChIKey | BTWJCJQSMQOTNR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |