About 3,5-dimethyl-4-methylsulfinyl-1,2-oxazole
3,5-dimethyl-4-methylsulfinyl-1,2-oxazole (PubChem CID 70320458) has the molecular formula C6H9NO2S
and a molecular weight of 159.21 g/mol. Its IUPAC name is 3,5-dimethyl-4-methylsulfinyl-1,2-oxazole.
Molecular Properties
| Compound Name | 3,5-dimethyl-4-methylsulfinyl-1,2-oxazole |
| PubChem CID | 70320458 |
| Molecular Formula | C6H9NO2S |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | 3,5-dimethyl-4-methylsulfinyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1S(C)=O |
| InChI | InChI=1S/C6H9NO2S/c1-4-6(10(3)8)5(2)9-7-4/h1-3H3 |
| InChIKey | BTWJCJQSMQOTNR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dimethyl-4-methylsulfinyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-4-methylsulfinyl-1,2-oxazole?
The IUPAC name of 3,5-dimethyl-4-methylsulfinyl-1,2-oxazole (CID 70320458) is 3,5-dimethyl-4-methylsulfinyl-1,2-oxazole.
What is the SMILES notation for 3,5-dimethyl-4-methylsulfinyl-1,2-oxazole?
The canonical SMILES for 3,5-dimethyl-4-methylsulfinyl-1,2-oxazole is Cc1noc(C)c1S(C)=O.
What is the InChIKey of 3,5-dimethyl-4-methylsulfinyl-1,2-oxazole?
The InChIKey is BTWJCJQSMQOTNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2S/c1-4-6(10(3)8)5(2)9-7-4/h1-3H3.
What are the key properties of 3,5-dimethyl-4-methylsulfinyl-1,2-oxazole?
3,5-dimethyl-4-methylsulfinyl-1,2-oxazole has a molecular weight of 159.21 g/mol, XLogP of 1.03, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-methylsulfinyl-1,2-oxazole is sourced from PubChem (CID 70320458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).