C25H37N3O2 — CID 70368257
N-[4-[2-(2,4-ditert-butylphenoxy)butylamino]anilino]formamide (PubChem CID 70368257) has the molecular formula C25H37N3O2 and a molecular weight of 411.59 g/mol. Its IUPAC name is N-[4-[2-(2,4-ditert-butylphenoxy)butylamino]anilino]formamide.
| Compound Name | N-[4-[2-(2,4-ditert-butylphenoxy)butylamino]anilino]formamide |
|---|---|
| PubChem CID | 70368257 |
| Molecular Formula | C25H37N3O2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | N-[4-[2-(2,4-ditert-butylphenoxy)butylamino]anilino]formamide |
| SMILES | CCC(CNc1ccc(NNC=O)cc1)Oc1ccc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C25H37N3O2/c1-8-21(16-26-19-10-12-20(13-11-19)28-27-17-29)30-23-14-9-18(24(2,3)4)15-22(23)25(5,6)7/h9-15,17,21,26,28H,8,16H2,1-7H3,(H,27,29) |
| InChIKey | KXMIYPRJTDRXIR-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|