C54H60O3 — CID 70431585
1-but-2-en-2-yl-4-[7-(3-ethoxyphenyl)-2,7-dimethyl-5,10-bis(3-phenoxyphenyl)decan-2-yl]benzene (PubChem CID 70431585) has the molecular formula C54H60O3 and a molecular weight of 757.07 g/mol. Its IUPAC name is 1-but-2-en-2-yl-4-[7-(3-ethoxyphenyl)-2,7-dimethyl-5,10-bis(3-phenoxyphenyl)decan-2-yl]benzene.
| Compound Name | 1-but-2-en-2-yl-4-[7-(3-ethoxyphenyl)-2,7-dimethyl-5,10-bis(3-phenoxyphenyl)decan-2-yl]benzene |
|---|---|
| PubChem CID | 70431585 |
| Molecular Formula | C54H60O3 |
| Molecular Weight | 757.07 g/mol |
| Exact Mass | 756.45 |
| IUPAC Name | 1-but-2-en-2-yl-4-[7-(3-ethoxyphenyl)-2,7-dimethyl-5,10-bis(3-phenoxyphenyl)decan-2-yl]benzene |
| SMILES | CC=C(C)c1ccc(C(C)(C)CCC(CC(C)(CCCc2cccc(Oc3ccccc3)c2)c2cccc(OCC)c2)c2cccc(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C54H60O3/c1-7-41(3)43-30-32-46(33-31-43)53(4,5)36-34-45(44-21-16-29-52(38-44)57-49-25-13-10-14-26-49)40-54(6,47-22-17-27-50(39-47)55-8-2)35-18-20-42-19-15-28-51(37-42)56-48-23-11-9-12-24-48/h7,9-17,19,21-33,37-39,45H,8,18,20,34-36,40H2,1-6H3 |
| InChIKey | SVHPVHIVQVLABJ-UHFFFAOYSA-N |
| XLogP | 15.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.07 |
| LogP ≤ 5 | 15.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |