C27H51N3O7S — CID 70469229
(2S,5R,6S)-6-[(2-aminoacetyl)oxymethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;tetrabutylazanium (PubChem CID 70469229) has the molecular formula C27H51N3O7S and a molecular weight of 561.79 g/mol. Its IUPAC name is (2S,5R,6S)-6-[(2-aminoacetyl)oxymethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;tetrabutylazanium.
| Compound Name | (2S,5R,6S)-6-[(2-aminoacetyl)oxymethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;tetrabutylazanium |
|---|---|
| PubChem CID | 70469229 |
| Molecular Formula | C27H51N3O7S |
| Molecular Weight | 561.79 g/mol |
| Exact Mass | 561.34 |
| IUPAC Name | (2S,5R,6S)-6-[(2-aminoacetyl)oxymethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;tetrabutylazanium |
| SMILES | CC1(C)[C@H](C(=O)[O-])N2C(=O)[C@H](COC(=O)CN)[C@H]2S1(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H36N.C11H16N2O7S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-11(2)7(10(16)17)13-8(15)5(4-20-6(14)3-12)9(13)21(11,18)19/h5-16H2,1-4H3;5,7,9H,3-4,12H2,1-2H3,(H,16,17)/q+1;/p-1/t;5-,7-,9+/m.0/s1 |
| InChIKey | RRGORXAKNHXKKS-ABOOPVDFSA-M |
| XLogP | 1.60 |
| TPSA | 146.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.79 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|