C10H16S2 — CID 70470740
3-ethyl-2,3,5,6,7,8-hexahydro-1,4-benzodithiine (PubChem CID 70470740) has the molecular formula C10H16S2 and a molecular weight of 200.37 g/mol. Its IUPAC name is 3-ethyl-2,3,5,6,7,8-hexahydro-1,4-benzodithiine.
| Compound Name | 3-ethyl-2,3,5,6,7,8-hexahydro-1,4-benzodithiine |
|---|---|
| PubChem CID | 70470740 |
| Molecular Formula | C10H16S2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 3-ethyl-2,3,5,6,7,8-hexahydro-1,4-benzodithiine |
| SMILES | CCC1CSC2=C(CCCC2)S1 |
| InChI | InChI=1S/C10H16S2/c1-2-8-7-11-9-5-3-4-6-10(9)12-8/h8H,2-7H2,1H3 |
| InChIKey | MXCYSRJCTSJLSA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |