C17H21NO3 — CID 70470813
4-[2-hydroxy-2-(N-propylanilino)ethyl]benzene-1,2-diol (PubChem CID 70470813) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-[2-hydroxy-2-(N-propylanilino)ethyl]benzene-1,2-diol.
| Compound Name | 4-[2-hydroxy-2-(N-propylanilino)ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 70470813 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 4-[2-hydroxy-2-(N-propylanilino)ethyl]benzene-1,2-diol |
| SMILES | CCCN(c1ccccc1)C(O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H21NO3/c1-2-10-18(14-6-4-3-5-7-14)17(21)12-13-8-9-15(19)16(20)11-13/h3-9,11,17,19-21H,2,10,12H2,1H3 |
| InChIKey | MPLTZVSGMCTKQR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|