C22H23N3O9S — CID 70501517
(4-nitrophenyl)methyl 3-(1-acetamidoethylsulfanyl)-6-(4-methyl-2-oxo-1,3-dioxolan-4-yl)-7-oxo-1-azabicyclo[3.2.0]hept-3-ene-2-carboxylate (PubChem CID 70501517) has the molecular formula C22H23N3O9S and a molecular weight of 505.51 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-(1-acetamidoethylsulfanyl)-6-(4-methyl-2-oxo-1,3-dioxolan-4-yl)-7-oxo-1-azabicyclo[3.2.0]hept-3-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 3-(1-acetamidoethylsulfanyl)-6-(4-methyl-2-oxo-1,3-dioxolan-4-yl)-7-oxo-1-azabicyclo[3.2.0]hept-3-ene-2-carboxylate |
|---|---|
| PubChem CID | 70501517 |
| Molecular Formula | C22H23N3O9S |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | (4-nitrophenyl)methyl 3-(1-acetamidoethylsulfanyl)-6-(4-methyl-2-oxo-1,3-dioxolan-4-yl)-7-oxo-1-azabicyclo[3.2.0]hept-3-ene-2-carboxylate |
| SMILES | CC(=O)NC(C)SC1=CC2C(C3(C)COC(=O)O3)C(=O)N2C1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H23N3O9S/c1-11(26)23-12(2)35-16-8-15-17(22(3)10-33-21(29)34-22)19(27)24(15)18(16)20(28)32-9-13-4-6-14(7-5-13)25(30)31/h4-8,12,15,17-18H,9-10H2,1-3H3,(H,23,26) |
| InChIKey | GDKSJXPVAQZECG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|