C18H18N2O9 — CID 54431472
(4-nitrophenyl)methyl 2-[3-(4-methyl-2-oxo-1,3-dioxolan-4-yl)-4-oxoazetidin-2-yl]-3-oxobutanoate (PubChem CID 54431472) has the molecular formula C18H18N2O9 and a molecular weight of 406.35 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[3-(4-methyl-2-oxo-1,3-dioxolan-4-yl)-4-oxoazetidin-2-yl]-3-oxobutanoate.
| Compound Name | (4-nitrophenyl)methyl 2-[3-(4-methyl-2-oxo-1,3-dioxolan-4-yl)-4-oxoazetidin-2-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 54431472 |
| Molecular Formula | C18H18N2O9 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[3-(4-methyl-2-oxo-1,3-dioxolan-4-yl)-4-oxoazetidin-2-yl]-3-oxobutanoate |
| SMILES | CC(=O)C(C(=O)OCc1ccc([N+](=O)[O-])cc1)C1NC(=O)C1C1(C)COC(=O)O1 |
| InChI | InChI=1S/C18H18N2O9/c1-9(21)12(14-13(15(22)19-14)18(2)8-28-17(24)29-18)16(23)27-7-10-3-5-11(6-4-10)20(25)26/h3-6,12-14H,7-8H2,1-2H3,(H,19,22) |
| InChIKey | WHTWFDOJMWIMKV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 151.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|