C18H25N3O4S — CID 70528120
N-(5-hexan-3-yl-1,3,4-thiadiazol-2-yl)-2,4,6-trimethoxybenzamide (PubChem CID 70528120) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is N-(5-hexan-3-yl-1,3,4-thiadiazol-2-yl)-2,4,6-trimethoxybenzamide.
| Compound Name | N-(5-hexan-3-yl-1,3,4-thiadiazol-2-yl)-2,4,6-trimethoxybenzamide |
|---|---|
| PubChem CID | 70528120 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-(5-hexan-3-yl-1,3,4-thiadiazol-2-yl)-2,4,6-trimethoxybenzamide |
| SMILES | CCCC(CC)c1nnc(NC(=O)c2c(OC)cc(OC)cc2OC)s1 |
| InChI | InChI=1S/C18H25N3O4S/c1-6-8-11(7-2)17-20-21-18(26-17)19-16(22)15-13(24-4)9-12(23-3)10-14(15)25-5/h9-11H,6-8H2,1-5H3,(H,19,21,22) |
| InChIKey | HVXRYNBEJJCFLA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |