C18H25N3O4S — CID 70533815
4-[1-hydroxy-2-[4-(pyrimidin-5-ylmethoxy)butylamino]ethyl]-2-methylsulfinylphenol (PubChem CID 70533815) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is 4-[1-hydroxy-2-[4-(pyrimidin-5-ylmethoxy)butylamino]ethyl]-2-methylsulfinylphenol.
| Compound Name | 4-[1-hydroxy-2-[4-(pyrimidin-5-ylmethoxy)butylamino]ethyl]-2-methylsulfinylphenol |
|---|---|
| PubChem CID | 70533815 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-[1-hydroxy-2-[4-(pyrimidin-5-ylmethoxy)butylamino]ethyl]-2-methylsulfinylphenol |
| SMILES | CS(=O)c1cc(C(O)CNCCCCOCc2cncnc2)ccc1O |
| InChI | InChI=1S/C18H25N3O4S/c1-26(24)18-8-15(4-5-16(18)22)17(23)11-19-6-2-3-7-25-12-14-9-20-13-21-10-14/h4-5,8-10,13,17,19,22-23H,2-3,6-7,11-12H2,1H3 |
| InChIKey | IJSPDHHYXAYOQO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|