C21H31NO8 — CID 70538575
2-[6-(methoxymethyl)naphthalen-2-yl]acetic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol (PubChem CID 70538575) has the molecular formula C21H31NO8 and a molecular weight of 425.48 g/mol. Its IUPAC name is 2-[6-(methoxymethyl)naphthalen-2-yl]acetic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | 2-[6-(methoxymethyl)naphthalen-2-yl]acetic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 70538575 |
| Molecular Formula | C21H31NO8 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 2-[6-(methoxymethyl)naphthalen-2-yl]acetic acid;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
| SMILES | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.COCc1ccc2cc(CC(=O)O)ccc2c1 |
| InChI | InChI=1S/C14H14O3.C7H17NO5/c1-17-9-11-3-5-12-6-10(8-14(15)16)2-4-13(12)7-11;1-8-2-4(10)6(12)7(13)5(11)3-9/h2-7H,8-9H2,1H3,(H,15,16);4-13H,2-3H2,1H3/t;4-,5+,6+,7+/m.0/s1 |
| InChIKey | FYIQAZMFVMOTHK-WZTVWXICSA-N |
| XLogP | -0.75 |
| TPSA | 159.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |