C18H24NO3+ — CID 7055375
2,2-dimethoxyethyl-[(1S,2S)-2-hydroxy-1,2-diphenylethyl]azanium (PubChem CID 7055375) has the molecular formula C18H24NO3+ and a molecular weight of 302.39 g/mol. Its IUPAC name is 2,2-dimethoxyethyl-[(1S,2S)-2-hydroxy-1,2-diphenylethyl]azanium.
| Compound Name | 2,2-dimethoxyethyl-[(1S,2S)-2-hydroxy-1,2-diphenylethyl]azanium |
|---|---|
| PubChem CID | 7055375 |
| Molecular Formula | C18H24NO3+ |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 2,2-dimethoxyethyl-[(1S,2S)-2-hydroxy-1,2-diphenylethyl]azanium |
| SMILES | COC(C[NH2+][C@@H](c1ccccc1)[C@@H](O)c1ccccc1)OC |
| InChI | InChI=1S/C18H23NO3/c1-21-16(22-2)13-19-17(14-9-5-3-6-10-14)18(20)15-11-7-4-8-12-15/h3-12,16-20H,13H2,1-2H3/p+1/t17-,18-/m0/s1 |
| InChIKey | QUBDABGAJOMQTH-ROUUACIJSA-O |
| XLogP | 1.64 |
| TPSA | 55.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|