C9H15NO2 — CID 7061763
2,2,5,5-tetramethyl-1H-pyrrol-1-ium-3-carboxylate (PubChem CID 7061763) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-1H-pyrrol-1-ium-3-carboxylate.
| Compound Name | 2,2,5,5-tetramethyl-1H-pyrrol-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 7061763 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 2,2,5,5-tetramethyl-1H-pyrrol-1-ium-3-carboxylate |
| SMILES | CC1(C)C=C(C(=O)[O-])C(C)(C)[NH2+]1 |
| InChI | InChI=1S/C9H15NO2/c1-8(2)5-6(7(11)12)9(3,4)10-8/h5,10H,1-4H3,(H,11,12) |
| InChIKey | HQOIHPZSNFLRRG-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |