C14H16Cl3N5O4 — CID 70625701
butyl 2-purin-7-yl-2-(2,2,2-trichloroethoxycarbonylamino)acetate (PubChem CID 70625701) has the molecular formula C14H16Cl3N5O4 and a molecular weight of 424.67 g/mol. Its IUPAC name is butyl 2-purin-7-yl-2-(2,2,2-trichloroethoxycarbonylamino)acetate.
| Compound Name | butyl 2-purin-7-yl-2-(2,2,2-trichloroethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 70625701 |
| Molecular Formula | C14H16Cl3N5O4 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | butyl 2-purin-7-yl-2-(2,2,2-trichloroethoxycarbonylamino)acetate |
| SMILES | CCCCOC(=O)C(NC(=O)OCC(Cl)(Cl)Cl)n1cnc2ncncc21 |
| InChI | InChI=1S/C14H16Cl3N5O4/c1-2-3-4-25-12(23)11(21-13(24)26-6-14(15,16)17)22-8-20-10-9(22)5-18-7-19-10/h5,7-8,11H,2-4,6H2,1H3,(H,21,24) |
| InChIKey | UOLFSVUSPFSXLI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|