C9H10Cl3N3O3 — CID 86245271
2,2,2-trichloroethyl N-(4-ethoxypyrimidin-5-yl)carbamate (PubChem CID 86245271) has the molecular formula C9H10Cl3N3O3 and a molecular weight of 314.56 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-(4-ethoxypyrimidin-5-yl)carbamate.
| Compound Name | 2,2,2-trichloroethyl N-(4-ethoxypyrimidin-5-yl)carbamate |
|---|---|
| PubChem CID | 86245271 |
| Molecular Formula | C9H10Cl3N3O3 |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | 2,2,2-trichloroethyl N-(4-ethoxypyrimidin-5-yl)carbamate |
| SMILES | CCOc1ncncc1NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H10Cl3N3O3/c1-2-17-7-6(3-13-5-14-7)15-8(16)18-4-9(10,11)12/h3,5H,2,4H2,1H3,(H,15,16) |
| InChIKey | RDJYPDXOIVYAQZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|