C33H45F3N2O3S — CID 70634215
1-[4-heptyl-1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl propanoate (PubChem CID 70634215) has the molecular formula C33H45F3N2O3S and a molecular weight of 606.80 g/mol. Its IUPAC name is 1-[4-heptyl-1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl propanoate.
| Compound Name | 1-[4-heptyl-1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl propanoate |
|---|---|
| PubChem CID | 70634215 |
| Molecular Formula | C33H45F3N2O3S |
| Molecular Weight | 606.80 g/mol |
| Exact Mass | 606.31 |
| IUPAC Name | 1-[4-heptyl-1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl propanoate |
| SMILES | CCCCCCCC1(OC(C)OC(=O)CC)CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C33H45F3N2O3S/c1-4-6-7-8-11-17-32(41-25(3)40-31(39)5-2)18-22-37(23-19-32)20-12-21-38-27-13-9-10-14-29(27)42-30-16-15-26(24-28(30)38)33(34,35)36/h9-10,13-16,24-25H,4-8,11-12,17-23H2,1-3H3 |
| InChIKey | FBHFOWSTHCLXCC-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.80 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|