About heptan-2-yl 2-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl carbonate
heptan-2-yl 2-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl carbonate (PubChem CID 154418587) has the molecular formula C31H41F3N2O4S
and a molecular weight of 594.74 g/mol. Its IUPAC name is heptan-2-yl 2-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl carbonate.
Molecular Properties
| Compound Name | heptan-2-yl 2-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl carbonate |
| PubChem CID | 154418587 |
| Molecular Formula | C31H41F3N2O4S |
| Molecular Weight | 594.74 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | heptan-2-yl 2-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl carbonate |
| SMILES | CCCCCC(C)OC(=O)OCCOC1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C31H41F3N2O4S/c1-3-4-5-9-23(2)40-30(37)39-21-20-38-25-14-18-35(19-15-25)16-8-17-36-26-10-6-7-11-28(26)41-29-13-12-24(22-27(29)36)31(32,33)34/h6-7,10-13,22-23,25H,3-5,8-9,14-21H2,1-2H3 |
| InChIKey | ZCEJOWPKPKDKTQ-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 594.74 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptan-2-yl 2-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-2-yl 2-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl carbonate?
The IUPAC name of heptan-2-yl 2-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl carbonate (CID 154418587) is heptan-2-yl 2-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl carbonate.
What is the SMILES notation for heptan-2-yl 2-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl carbonate?
The canonical SMILES for heptan-2-yl 2-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl carbonate is CCCCCC(C)OC(=O)OCCOC1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1.
What is the InChIKey of heptan-2-yl 2-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl carbonate?
The InChIKey is ZCEJOWPKPKDKTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H41F3N2O4S/c1-3-4-5-9-23(2)40-30(37)39-21-20-38-25-14-18-35(19-15-25)16-8-17-36-26-10-6-7-11-28(26)41-29-13-12-24(22-27(29)36)31(32,33)34/h6-7,10-13,22-23,25H,3-5,8-9,14-21H2,1-2H3.
What are the key properties of heptan-2-yl 2-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl carbonate?
heptan-2-yl 2-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl carbonate has a molecular weight of 594.74 g/mol, XLogP of 8.30, 13 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-2-yl 2-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl carbonate is sourced from PubChem (CID 154418587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).