C30H45F3N4O2S — CID 142332204
3-amino-3-methoxybutan-1-ol;10-[3-[4-(3-methylbutyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine (PubChem CID 142332204) has the molecular formula C30H45F3N4O2S and a molecular weight of 582.78 g/mol. Its IUPAC name is 3-amino-3-methoxybutan-1-ol;10-[3-[4-(3-methylbutyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine.
| Compound Name | 3-amino-3-methoxybutan-1-ol;10-[3-[4-(3-methylbutyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine |
|---|---|
| PubChem CID | 142332204 |
| Molecular Formula | C30H45F3N4O2S |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.32 |
| IUPAC Name | 3-amino-3-methoxybutan-1-ol;10-[3-[4-(3-methylbutyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine |
| SMILES | CC(C)CCN1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1.COC(C)(N)CCO |
| InChI | InChI=1S/C25H32F3N3S.C5H13NO2/c1-19(2)10-13-30-16-14-29(15-17-30)11-5-12-31-21-6-3-4-7-23(21)32-24-9-8-20(18-22(24)31)25(26,27)28;1-5(6,8-2)3-4-7/h3-4,6-9,18-19H,5,10-17H2,1-2H3;7H,3-4,6H2,1-2H3 |
| InChIKey | VQZFTTZNCZFKCA-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|