C32H33Cl3F3N3O3S — CID 87893630
2-[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethyl 2-methyl-3-(3,4,5-trichlorophenoxy)propanoate (PubChem CID 87893630) has the molecular formula C32H33Cl3F3N3O3S and a molecular weight of 703.05 g/mol. Its IUPAC name is 2-[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethyl 2-methyl-3-(3,4,5-trichlorophenoxy)propanoate.
| Compound Name | 2-[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethyl 2-methyl-3-(3,4,5-trichlorophenoxy)propanoate |
|---|---|
| PubChem CID | 87893630 |
| Molecular Formula | C32H33Cl3F3N3O3S |
| Molecular Weight | 703.05 g/mol |
| Exact Mass | 701.13 |
| IUPAC Name | 2-[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethyl 2-methyl-3-(3,4,5-trichlorophenoxy)propanoate |
| SMILES | CC(COc1cc(Cl)c(Cl)c(Cl)c1)C(=O)OCCN1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C32H33Cl3F3N3O3S/c1-21(20-44-23-18-24(33)30(35)25(34)19-23)31(42)43-16-15-40-13-11-39(12-14-40)9-4-10-41-26-5-2-3-6-28(26)45-29-8-7-22(17-27(29)41)32(36,37)38/h2-3,5-8,17-19,21H,4,9-16,20H2,1H3 |
| InChIKey | JUDUHINEGWJKFF-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.05 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|