C32H50F3N3O2S2 — CID 142332239
ethane;3-methoxysulfanylbutan-1-ol;10-[3-[4-(3-methylbutyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine (PubChem CID 142332239) has the molecular formula C32H50F3N3O2S2 and a molecular weight of 629.90 g/mol. Its IUPAC name is ethane;3-methoxysulfanylbutan-1-ol;10-[3-[4-(3-methylbutyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine.
| Compound Name | ethane;3-methoxysulfanylbutan-1-ol;10-[3-[4-(3-methylbutyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine |
|---|---|
| PubChem CID | 142332239 |
| Molecular Formula | C32H50F3N3O2S2 |
| Molecular Weight | 629.90 g/mol |
| Exact Mass | 629.33 |
| IUPAC Name | ethane;3-methoxysulfanylbutan-1-ol;10-[3-[4-(3-methylbutyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine |
| SMILES | CC.CC(C)CCN1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1.COSC(C)CCO |
| InChI | InChI=1S/C25H32F3N3S.C5H12O2S.C2H6/c1-19(2)10-13-30-16-14-29(15-17-30)11-5-12-31-21-6-3-4-7-23(21)32-24-9-8-20(18-22(24)31)25(26,27)28;1-5(3-4-6)8-7-2;1-2/h3-4,6-9,18-19H,5,10-17H2,1-2H3;5-6H,3-4H2,1-2H3;1-2H3 |
| InChIKey | UJCDIRWBXQUXSG-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.90 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|