C26H31F3N2O3S — CID 54039307
2-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl propanoate (PubChem CID 54039307) has the molecular formula C26H31F3N2O3S and a molecular weight of 508.61 g/mol. Its IUPAC name is 2-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl propanoate.
| Compound Name | 2-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl propanoate |
|---|---|
| PubChem CID | 54039307 |
| Molecular Formula | C26H31F3N2O3S |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 2-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethyl propanoate |
| SMILES | CCC(=O)OCCOC1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C26H31F3N2O3S/c1-2-25(32)34-17-16-33-20-10-14-30(15-11-20)12-5-13-31-21-6-3-4-7-23(21)35-24-9-8-19(18-22(24)31)26(27,28)29/h3-4,6-9,18,20H,2,5,10-17H2,1H3 |
| InChIKey | LLFBVESUNPNNTA-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|