C26H33F3N4O2 — CID 142223979
2-[4-[4-[3-(trifluoromethyl)-10H-phenazin-5-yl]butyl]piperazin-1-yl]ethyl propanoate (PubChem CID 142223979) has the molecular formula C26H33F3N4O2 and a molecular weight of 490.57 g/mol. Its IUPAC name is 2-[4-[4-[3-(trifluoromethyl)-10H-phenazin-5-yl]butyl]piperazin-1-yl]ethyl propanoate.
| Compound Name | 2-[4-[4-[3-(trifluoromethyl)-10H-phenazin-5-yl]butyl]piperazin-1-yl]ethyl propanoate |
|---|---|
| PubChem CID | 142223979 |
| Molecular Formula | C26H33F3N4O2 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 2-[4-[4-[3-(trifluoromethyl)-10H-phenazin-5-yl]butyl]piperazin-1-yl]ethyl propanoate |
| SMILES | CCC(=O)OCCN1CCN(CCCCN2c3ccccc3Nc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C26H33F3N4O2/c1-2-25(34)35-18-17-32-15-13-31(14-16-32)11-5-6-12-33-23-8-4-3-7-21(23)30-22-10-9-20(19-24(22)33)26(27,28)29/h3-4,7-10,19,30H,2,5-6,11-18H2,1H3 |
| InChIKey | TXBKWBFIGCZDEI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|