C22H34N6O4 — CID 70676311
3-[[(3aR,4R,6R,6aR)-2,2-dimethyl-4-[6-(prop-2-enylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-propan-2-ylamino]propan-1-ol (PubChem CID 70676311) has the molecular formula C22H34N6O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is 3-[[(3aR,4R,6R,6aR)-2,2-dimethyl-4-[6-(prop-2-enylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-propan-2-ylamino]propan-1-ol.
| Compound Name | 3-[[(3aR,4R,6R,6aR)-2,2-dimethyl-4-[6-(prop-2-enylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-propan-2-ylamino]propan-1-ol |
|---|---|
| PubChem CID | 70676311 |
| Molecular Formula | C22H34N6O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 3-[[(3aR,4R,6R,6aR)-2,2-dimethyl-4-[6-(prop-2-enylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-propan-2-ylamino]propan-1-ol |
| SMILES | C=CCNc1ncnc2c1ncn2[C@@H]1O[C@H](CN(CCCO)C(C)C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C22H34N6O4/c1-6-8-23-19-16-20(25-12-24-19)28(13-26-16)21-18-17(31-22(4,5)32-18)15(30-21)11-27(14(2)3)9-7-10-29/h6,12-15,17-18,21,29H,1,7-11H2,2-5H3,(H,23,24,25)/t15-,17-,18-,21-/m1/s1 |
| InChIKey | VKRANYQUPVRCPG-QTQZEZTPSA-N |
| XLogP | 1.93 |
| TPSA | 106.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|