C15H22N4O3S — CID 70740509
1-[(4aR,7aS)-1-(1H-imidazol-2-ylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-methylbut-2-en-1-one (PubChem CID 70740509) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is 1-[(4aR,7aS)-1-(1H-imidazol-2-ylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-methylbut-2-en-1-one.
| Compound Name | 1-[(4aR,7aS)-1-(1H-imidazol-2-ylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 70740509 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-[(4aR,7aS)-1-(1H-imidazol-2-ylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-methylbut-2-en-1-one |
| SMILES | CC(C)=CC(=O)N1CCN(Cc2ncc[nH]2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C15H22N4O3S/c1-11(2)7-15(20)19-6-5-18(8-14-16-3-4-17-14)12-9-23(21,22)10-13(12)19/h3-4,7,12-13H,5-6,8-10H2,1-2H3,(H,16,17)/t12-,13+/m1/s1 |
| InChIKey | WKBCTSPEXQVLIS-OLZOCXBDSA-N |
| XLogP | 0.19 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|