C20H28F3N3O2 — CID 70793908
N-[(2S)-1-[2-[(3S)-3-amino-4-(2,4,5-trifluorophenyl)butyl]-5-methylpyrrolidin-1-yl]-1-oxopropan-2-yl]acetamide (PubChem CID 70793908) has the molecular formula C20H28F3N3O2 and a molecular weight of 399.46 g/mol. Its IUPAC name is N-[(2S)-1-[2-[(3S)-3-amino-4-(2,4,5-trifluorophenyl)butyl]-5-methylpyrrolidin-1-yl]-1-oxopropan-2-yl]acetamide.
| Compound Name | N-[(2S)-1-[2-[(3S)-3-amino-4-(2,4,5-trifluorophenyl)butyl]-5-methylpyrrolidin-1-yl]-1-oxopropan-2-yl]acetamide |
|---|---|
| PubChem CID | 70793908 |
| Molecular Formula | C20H28F3N3O2 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | N-[(2S)-1-[2-[(3S)-3-amino-4-(2,4,5-trifluorophenyl)butyl]-5-methylpyrrolidin-1-yl]-1-oxopropan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C)C(=O)N1C(C)CCC1CC[C@H](N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C20H28F3N3O2/c1-11-4-6-16(26(11)20(28)12(2)25-13(3)27)7-5-15(24)8-14-9-18(22)19(23)10-17(14)21/h9-12,15-16H,4-8,24H2,1-3H3,(H,25,27)/t11?,12-,15-,16?/m0/s1 |
| InChIKey | APDRZDAYCSXYTN-IAWSLSPSSA-N |
| XLogP | 2.66 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|